2-Sulfanylnicotinonitrile
Catalog No: FT-0680840
CAS No: 52505-45-0
- Chemical Name: 2-Sulfanylnicotinonitrile
- Molecular Formula: C6H4N2S
- Molecular Weight: 136.18
- InChI Key: VKEKYGNDJZUZTL-UHFFFAOYSA-N
- InChI: InChI=1S/C6H4N2S/c7-4-5-2-1-3-8-6(5)9/h1-3H,(H,8,9)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 136.17400 |
| Density: | 1.32g/cm3 |
| CAS: | 52505-45-0 |
| Bolling_Point: | 229.6ºC at 760mmHg |
| Product_Name: | 2-sulfanylidene-1H-pyridine-3-carbonitrile |
| Melting_Point: | 248-250ºC |
| Flash_Point: | 92.7ºC |
| MF: | C6H4N2S |
| Density: | 1.32g/cm3 |
|---|---|
| LogP: | 1.24198 |
| Flash_Point: | 92.7ºC |
| Melting_Point: | 248-250ºC |
| FW: | 136.17400 |
| PSA: | 75.48000 |
| Exact_Mass: | 136.01000 |
| MF: | C6H4N2S |
| Bolling_Point: | 229.6ºC at 760mmHg |
| Refractive_Index: | 1.664 |
| Warning_Statement: | P280-P305 + P351 + P338 |
|---|---|
| Safety_Statements: | H302-H318 |
| Symbol: | Danger |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)